![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
3 Chairs |
20-Apr-2018 16:20 |
- |
|
|
40 Below Summer |
20-Apr-2018 16:20 |
- |
|
|
AFRICAN GARAGE |
20-Apr-2018 16:20 |
- |
|
|
Absence Of Light |
20-Apr-2018 16:20 |
- |
|
|
Abstrakt Knights ⁄ On⁄Off |
20-Apr-2018 16:20 |
- |
|
|
Acid Dream |
20-Apr-2018 16:20 |
- |
|
|
Adegan |
20-Apr-2018 16:20 |
- |
|
|
Aeba |
20-Apr-2018 16:20 |
- |
|
|
Against Kids |
20-Apr-2018 16:20 |
- |
|
|
Aki Sirkesalo |
20-Apr-2018 16:20 |
- |
|
|
Alan Kelly |
20-Apr-2018 16:20 |
- |
|
|
Alex Kidd |
20-Apr-2018 16:20 |
- |
|
|
Almila, Nordgren, Kokkonen; Arktinen hysteria |
20-Apr-2018 16:20 |
- |
|
|
Amat Amigos |
20-Apr-2018 16:20 |
- |
|
|
Angel-Ho |
20-Apr-2018 16:20 |
- |
|
|
Angeles |
20-Apr-2018 16:20 |
- |
|
|
Anton Milton & Glorified |
20-Apr-2018 16:20 |
- |
|
|
Antonín Dvořák; London Philharmonic Orchestra, Sir Charles Mackerras |
20-Apr-2018 16:20 |
- |
|
|
Area 51 |
20-Apr-2018 16:20 |
- |
|
|
Arkon Fly |
20-Apr-2018 16:20 |
- |
|
|
Arnold Schönberg; Juilliard String Quartet |
20-Apr-2018 16:20 |
- |
|
|
Artur Rojek |
20-Apr-2018 16:20 |
- |
|
|
Audio Code |
20-Apr-2018 16:20 |
- |
|
|
Augusten Burroughs gelesen von August Diehl |
20-Apr-2018 16:20 |
- |
|
|
Bach; Murray Perahia |
20-Apr-2018 16:20 |
- |
|
|
Bang on a Can |
20-Apr-2018 16:20 |
- |
|
|
Bartók; Christa Ludwig, Walter Berry, London Symphony Orchestra, István Kertész |
20-Apr-2018 16:20 |
- |
|
|
Berliner Philharmoniker & Simon Rattle |
20-Apr-2018 16:20 |
- |
|
|
Bert Weedon |
20-Apr-2018 16:20 |
- |
|
|
Black Attack |
20-Apr-2018 16:20 |
- |
|
|
Boomerang |
20-Apr-2018 16:20 |
- |
|
|
Brahms; Domus |
20-Apr-2018 16:20 |
- |
|
|
Brahms; Yehudi Menuhin, Willi Boskovsky, Emanuel Brabec, Orchestre du Festival de Lucerne, Wiener Philharmoniker, Wilhelm Furtwängler |
20-Apr-2018 16:20 |
- |
|
|
Braquemard |
20-Apr-2018 16:20 |
- |
|
|
Britten, Bryars, Tavener; Matthew Barley |
20-Apr-2018 16:20 |
- |
|
|
Cactus Child |
20-Apr-2018 16:20 |
- |
|
|
Cassle |
20-Apr-2018 16:20 |
- |
|
|
Chaos Blood |
20-Apr-2018 16:20 |
- |
|
|
Christina Aguilera feat. Redman |
20-Apr-2018 16:20 |
- |
|
|
Counterfist |
20-Apr-2018 16:20 |
- |
|
|
Cumhurbaşkanlığı Klasik Türk Müziği Korosu |
20-Apr-2018 16:20 |
- |
|
|
Curare |
20-Apr-2018 16:20 |
- |
|
|
Cycle of the Raven Talons |
20-Apr-2018 16:20 |
- |
|
|
DJ Baku |
20-Apr-2018 16:20 |
- |
|
|
DJ Dero |
20-Apr-2018 16:20 |
- |
|
|
DJ Ninja Love Mistake |
20-Apr-2018 16:20 |
- |
|
|
DJ Q |
20-Apr-2018 16:20 |
- |
|
|
DaMonz |
20-Apr-2018 16:20 |
- |
|
|
Dagmar Hoßfeld gelesen von Ann-Cathrin Sudhoff |
20-Apr-2018 16:20 |
- |
|
|
Damien Dempsey |
20-Apr-2018 16:20 |
- |
|
|
Dance Reaction |
20-Apr-2018 16:20 |
- |
|
|
Darkeater |
20-Apr-2018 16:20 |
- |
|
|
Davie Forbes |
20-Apr-2018 16:20 |
- |
|
|
Davie Forbes & M.C. Cyclone |
20-Apr-2018 16:20 |
- |
|
|
Dead by Morning |
20-Apr-2018 16:20 |
- |
|
|
Defiance |
20-Apr-2018 16:20 |
- |
|
|
Den Saakaldte |
20-Apr-2018 16:20 |
- |
|
|
Dick Heckstall-Smith and friends |
20-Apr-2018 16:20 |
- |
|
|
Die Funkhausgruppe |
20-Apr-2018 16:20 |
- |
|
|
Die kranken Schwestern |
20-Apr-2018 16:20 |
- |
|
|
Dominik Eulberg & Gabriel Ananda |
20-Apr-2018 16:20 |
- |
|
|
Dorisburg |
20-Apr-2018 16:20 |
- |
|
|
Doug Tielli |
20-Apr-2018 16:20 |
- |
|
|
Downcity Armory |
20-Apr-2018 16:20 |
- |
|
|
E. Fugu |
20-Apr-2018 16:20 |
- |
|
|
E.B. Daddy of Da Hood |
20-Apr-2018 16:20 |
- |
|
|
East 57th St. feat. Donna Allen |
20-Apr-2018 16:20 |
- |
|
|
Eastern Sidekick |
20-Apr-2018 16:20 |
- |
|
|
Eatmewhileimhot! |
20-Apr-2018 16:20 |
- |
|
|
Ebe'n'Drum |
20-Apr-2018 16:20 |
- |
|
|
Effello & Niko |
20-Apr-2018 16:20 |
- |
|
|
Embryo feat. Chris Karrer, El Hussaine Kili, Yoruba Dun Dun Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Emily Mure |
20-Apr-2018 16:20 |
- |
|
|
Ephemer |
20-Apr-2018 16:20 |
- |
|
|
Example + DJ Wire |
20-Apr-2018 16:20 |
- |
|
|
Exploding Head Syndrome |
20-Apr-2018 16:20 |
- |
|
|
Federico Locchi & Frankie Watch |
20-Apr-2018 16:20 |
- |
|
|
FireLake |
20-Apr-2018 16:20 |
- |
|
|
Flavel & Neto |
20-Apr-2018 16:20 |
- |
|
|
Formerly Known as Oedipusaurus Rex |
20-Apr-2018 16:20 |
- |
|
|
Frishiro |
20-Apr-2018 16:20 |
- |
|
|
Füxa |
20-Apr-2018 16:20 |
- |
|
|
GOL |
20-Apr-2018 16:20 |
- |
|
|
Gershwin; Michael Tilson Thomas, Eugene Ormandy |
20-Apr-2018 16:20 |
- |
|
|
Giovanni Girolamo Kapsberger ; L'Arpeggiata, Christina Pluhar |
20-Apr-2018 16:20 |
- |
|
|
Gormenghast |
20-Apr-2018 16:20 |
- |
|
|
Gosia Andrzejewicz |
20-Apr-2018 16:20 |
- |
|
|
Grindsuffering |
20-Apr-2018 16:20 |
- |
|
|
Group of the Altos |
20-Apr-2018 16:20 |
- |
|
|
Gunja |
20-Apr-2018 16:20 |
- |
|
|
Hands on The Stereo |
20-Apr-2018 16:20 |
- |
|
|
Hanna Talikainen |
20-Apr-2018 16:20 |
- |
|
|
Harriet Cohen |
20-Apr-2018 16:20 |
- |
|
|
Headache City |
20-Apr-2018 16:20 |
- |
|
|
Henderwyd |
20-Apr-2018 16:20 |
- |
|
|
Hip Optimist |
20-Apr-2018 16:20 |
- |
|
|
Hocus Pocus |
20-Apr-2018 16:20 |
- |
|
|
Hypocras |
20-Apr-2018 16:20 |
- |
|
|
ICATCHFIRE |
20-Apr-2018 16:20 |
- |
|
|
Immortal Empire |
20-Apr-2018 16:20 |
- |
|
|
Infectious Catheter Therapy |
20-Apr-2018 16:20 |
- |
|
|
Ismo Alanko Säätiö |
20-Apr-2018 16:20 |
- |
|
|
Janet feat. Q‐Tip & Joni Mitchell |
20-Apr-2018 16:20 |
- |
|
|
Jari Perkiömäki Quartet |
20-Apr-2018 16:20 |
- |
|
|
Jean-François Laporte |
20-Apr-2018 16:20 |
- |
|
|
Jerry Hadley |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach; Yehudi Menuhin, Christian Ferras, Robert Masters Chamber Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Johannes Brahms; Eugen Jochum, Jessye Norman, Jorma Hynninen, Klaus Tennstedt |
20-Apr-2018 16:20 |
- |
|
|
Johannes Heil |
20-Apr-2018 16:20 |
- |
|
|
John & Jacob |
20-Apr-2018 16:20 |
- |
|
|
John Cutrone |
20-Apr-2018 16:20 |
- |
|
|
John Kongos |
20-Apr-2018 16:20 |
- |
|
|
Johnny Legend & His Rockabilly Bastards |
20-Apr-2018 16:20 |
- |
|
|
Jonell Mosser |
20-Apr-2018 16:20 |
- |
|
|
Juliet Lyons |
20-Apr-2018 16:20 |
- |
|
|
June |
20-Apr-2018 16:20 |
- |
|
|
K A Morton |
20-Apr-2018 16:20 |
- |
|
|
Kahitna |
20-Apr-2018 16:20 |
- |
|
|
Kauko Röyhkä & Mikkelin kaupungin jousiorkesteri |
20-Apr-2018 16:20 |
- |
|
|
Kenny Kilgore |
20-Apr-2018 16:20 |
- |
|
|
Kill the Precedent |
20-Apr-2018 16:20 |
- |
|
|
Kortatu ⁄ Cicatriz ⁄ Jotakie ⁄ Kontuz Hi! |
20-Apr-2018 16:20 |
- |
|
|
Kovács Kati, Szécsi Pál, Zalatnay Sarolta, Aradszky László, Poór Péter, Kovács József, Mary Zsuzsi, Zorán, Illés & Koós János |
20-Apr-2018 16:20 |
- |
|
|
Kowton vs Bashmore |
20-Apr-2018 16:20 |
- |
|
|
Kozeljnik |
20-Apr-2018 16:20 |
- |
|
|
Kuunkuiskaajat |
20-Apr-2018 16:20 |
- |
|
|
Laura Babineau |
20-Apr-2018 16:20 |
- |
|
|
Les Cris de Paris |
20-Apr-2018 16:20 |
- |
|
|
Les Passants |
20-Apr-2018 16:20 |
- |
|
|
Les Percussions de Guinée avec El Hadj Djeli Sory Kouyate |
20-Apr-2018 16:20 |
- |
|
|
Lihkören |
20-Apr-2018 16:20 |
- |
|
|
London Symphony Orchestra, Richard Bonynge |
20-Apr-2018 16:20 |
- |
|
|
Lord Hakim |
20-Apr-2018 16:20 |
- |
|
|
Louise Korthals |
20-Apr-2018 16:20 |
- |
|
|
Lucy Marsh ⁄ Columbia Quartet |
20-Apr-2018 16:20 |
- |
|
|
Ludwig van Beethoven; London Symphony Orchestra, Antal Doráti |
20-Apr-2018 16:20 |
- |
|
|
M-Seven |
20-Apr-2018 16:20 |
- |
|
|
MALIO |
20-Apr-2018 16:20 |
- |
|
|
MIAVA |
20-Apr-2018 16:20 |
- |
|
|
Malkit Singh |
20-Apr-2018 16:20 |
- |
|
|
Masahiko Kimura, Motoaki Furukawa & Mariko Egawa |
20-Apr-2018 16:20 |
- |
|
|
Mascot Fight |
20-Apr-2018 16:20 |
- |
|
|
Massimo |
20-Apr-2018 16:20 |
- |
|
|
Massive Attack vs. Burial |
20-Apr-2018 16:20 |
- |
|
|
Mathys Roets |
20-Apr-2018 16:20 |
- |
|
|
Max Reger, Eugène Ysaÿe; Erling Blöndal Bengtsson |
20-Apr-2018 16:20 |
- |
|
|
Maxxwell & Tempesta |
20-Apr-2018 16:20 |
- |
|
|
Mexvin |
20-Apr-2018 16:20 |
- |
|
|
Miroslav Kejmar, Capella Istropolitana, Petr Škvor |
20-Apr-2018 16:20 |
- |
|
|
Mirror of Deception |
20-Apr-2018 16:20 |
- |
|
|
Mitch Murder & Satellite Young |
20-Apr-2018 16:20 |
- |
|
|
Mohammed Rafi, Lata Mangeshkar, Manhar Udhas, Mala Sinha, Mahendra Kapoor & Poornima |
20-Apr-2018 16:20 |
- |
|
|
Mondrian Oak |
20-Apr-2018 16:20 |
- |
|
|
Morgenstern |
20-Apr-2018 16:20 |
- |
|
|
Mozart; The Academy of Ancient Music, Jaap Schröder, Christopher Hogwood |
20-Apr-2018 16:20 |
- |
|
|
Mozart; The Chamber Orchestra of Europe, James Galway, Marisa Robles |
20-Apr-2018 16:20 |
- |
|
|
Muddy Brothers |
20-Apr-2018 16:20 |
- |
|
|
Mundo Livre S⁄A |
20-Apr-2018 16:20 |
- |
|
|
Muzzle |
20-Apr-2018 16:20 |
- |
|
|
Narcotik Affluence |
20-Apr-2018 16:20 |
- |
|
|
Natascha Wright |
20-Apr-2018 16:20 |
- |
|
|
Neisha |
20-Apr-2018 16:20 |
- |
|
|
Nigel Eaton & Friends |
20-Apr-2018 16:20 |
- |
|
|
Night Hikes |
20-Apr-2018 16:20 |
- |
|
|
Ninja Camel |
20-Apr-2018 16:20 |
- |
|
|
No Fun |
20-Apr-2018 16:20 |
- |
|
|
No Sports |
20-Apr-2018 16:20 |
- |
|
|
Ojos Locos |
20-Apr-2018 16:20 |
- |
|
|
Over the Atlantic |
20-Apr-2018 16:20 |
- |
|
|
Pacho y Cirilo |
20-Apr-2018 16:20 |
- |
|
|
Pascal Gemme & Mario Loiselle |
20-Apr-2018 16:20 |
- |
|
|
Paul Norton |
20-Apr-2018 16:20 |
- |
|
|
Peace, Love & Pitbulls |
20-Apr-2018 16:20 |
- |
|
|
Platinium |
20-Apr-2018 16:20 |
- |
|
|
Pneumatic Detach ⁄ C2 |
20-Apr-2018 16:20 |
- |
|
|
Pollo Del Mar |
20-Apr-2018 16:20 |
- |
|
|
Posslust |
20-Apr-2018 16:20 |
- |
|
|
Pouca Sorte Deus da Morte |
20-Apr-2018 16:20 |
- |
|
|
Push Button Objects |
20-Apr-2018 16:20 |
- |
|
|
Quantum |
20-Apr-2018 16:20 |
- |
|
|
R.P. Boals & The Soals |
20-Apr-2018 16:20 |
- |
|
|
Rafael Toral ⁄ Davu Seru |
20-Apr-2018 16:20 |
- |
|
|
Rasmus |
20-Apr-2018 16:20 |
- |
|
|
Repulse |
20-Apr-2018 16:20 |
- |
|
|
Richard Wagner; Chor und Orchester der Bayerischen Staatsoper, Clemens Krauss |
20-Apr-2018 16:20 |
- |
|
|
Richard Wagner; Erich Leinsdorf, Metropolitan Opera Orchestra, Metropolitan Opera Chorus, Lauritz Melchior, Helen Traubel |
20-Apr-2018 16:20 |
- |
|
|
Rick Dees & His Cast of Idiots |
20-Apr-2018 16:20 |
- |
|
|
Rico |
20-Apr-2018 16:20 |
- |
|
|
Rod Davies |
20-Apr-2018 16:20 |
- |
|
|
Rodney D |
20-Apr-2018 16:20 |
- |
|
|
Rose Vialpando & Salomon Lopez |
20-Apr-2018 16:20 |
- |
|
|
Roses' Tribe |
20-Apr-2018 16:20 |
- |
|
|
Sabota |
20-Apr-2018 16:20 |
- |
|
|
Schallfaktor |
20-Apr-2018 16:20 |
- |
|
|
Sergei Lyapunov; BBC Scottish Symphony Orchestra, Martyn Brabbins, Hamish Milne |
20-Apr-2018 16:20 |
- |
|
|
Shauna Davis |
20-Apr-2018 16:20 |
- |
|
|
Shay |
20-Apr-2018 16:20 |
- |
|
|
Shit Kid |
20-Apr-2018 16:20 |
- |
|
|
Shock Poets |
20-Apr-2018 16:20 |
- |
|
|
Shostakovich, Prokofiev; Gustav Schmahl, Dresdner Philharmonie, Kurt Masur |
20-Apr-2018 16:20 |
- |
|
|
Sibelius; Scottish National Orchestra, Sir Alexander Gibson |
20-Apr-2018 16:20 |
- |
|
|
Solar Flare vs. Rorcal |
20-Apr-2018 16:20 |
- |
|
|
Spinee |
20-Apr-2018 16:20 |
- |
|
|
Star Insight |
20-Apr-2018 16:20 |
- |
|
|
Stimulant DJs |
20-Apr-2018 16:20 |
- |
|
|
Syllyk ⁄ Koji Marutani |
20-Apr-2018 16:20 |
- |
|
|
T.H.E. Rutto |
20-Apr-2018 16:20 |
- |
|
|
Tara Priya |
20-Apr-2018 16:20 |
- |
|
|
Texas Terri Bomb! |
20-Apr-2018 16:20 |
- |
|
|
The Beatles with Billy Preston |
20-Apr-2018 16:20 |
- |
|
|
The Chico Hamilton Quintet & Elmer Bernstein |
20-Apr-2018 16:20 |
- |
|
|
The Crowd Scene |
20-Apr-2018 16:20 |
- |
|
|
The Delmore Brothers |
20-Apr-2018 16:20 |
- |
|
|
The Drills |
20-Apr-2018 16:20 |
- |
|
|
The Hypnomen |
20-Apr-2018 16:20 |
- |
|
|
The Laughing Dogs |
20-Apr-2018 16:20 |
- |
|
|
The Lemonheads |
20-Apr-2018 16:20 |
- |
|
|
The Monarchs |
20-Apr-2018 16:20 |
- |
|
|
The Mor(R)ons |
20-Apr-2018 16:20 |
- |
|
|
The Red Hot Valentines ⁄ Retro Morning |
20-Apr-2018 16:20 |
- |
|
|
The UV Race |
20-Apr-2018 16:20 |
- |
|
|
The Waffle Machine Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Thee Oops |
20-Apr-2018 16:20 |
- |
|
|
Thorns of Hate |
20-Apr-2018 16:20 |
- |
|
|
Tommy Malone |
20-Apr-2018 16:20 |
- |
|
|
Trash the Dress |
20-Apr-2018 16:20 |
- |
|
|
Ultimate Buzz |
20-Apr-2018 16:20 |
- |
|
|
Ultraje a rigor |
20-Apr-2018 16:20 |
- |
|
|
Ur Draugr |
20-Apr-2018 16:20 |
- |
|
|
Veinte Tres |
20-Apr-2018 16:20 |
- |
|
|
Veirg |
20-Apr-2018 16:20 |
- |
|
|
Velcro Mary |
20-Apr-2018 16:20 |
- |
|
|
Voices of Kwahn |
20-Apr-2018 16:20 |
- |
|
|
Von Goat |
20-Apr-2018 16:20 |
- |
|
|
Went |
20-Apr-2018 16:20 |
- |
|
|
Willard Grant Conspiracy |
20-Apr-2018 16:20 |
- |
|
|
Willy Tea Taylor |
20-Apr-2018 16:20 |
- |
|
|
Wingdom |
20-Apr-2018 16:20 |
- |
|
|
Youth in Asia |
20-Apr-2018 16:20 |
- |
|
|
Zi:LiE-YA |
20-Apr-2018 16:20 |
- |
|
|
Zемфира |
20-Apr-2018 16:20 |
- |
|
|
bis ⁄ Ghosts of Dead Airplanes |
20-Apr-2018 16:20 |
- |
|
|
miLù |
20-Apr-2018 16:20 |
- |
|
|
sajjanu |
20-Apr-2018 16:20 |
- |
|
|
Μαρίκα Νίνου |
20-Apr-2018 16:20 |
- |
|
|
つじあやの |
20-Apr-2018 16:20 |
- |
|
|
ホッピー神山 |
20-Apr-2018 16:20 |
- |
|
|
久川綾 & 平松晶子 |
20-Apr-2018 16:20 |
- |
|
|
二手玫瑰 |
20-Apr-2018 16:20 |
- |
|
|
郭采潔 |
20-Apr-2018 16:20 |
- |
|
|
|---|