![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
 |
Parent Directory |
|
- |
|
 |
3 Chairs |
20-Apr-2018 16:20 |
- |
|
 |
40 Below Summer |
20-Apr-2018 16:20 |
- |
|
 |
AFRICAN GARAGE |
20-Apr-2018 16:20 |
- |
|
 |
Absence Of Light |
20-Apr-2018 16:20 |
- |
|
 |
Abstrakt Knights ⁄ On⁄Off |
20-Apr-2018 16:20 |
- |
|
 |
Acid Dream |
20-Apr-2018 16:20 |
- |
|
 |
Adegan |
20-Apr-2018 16:20 |
- |
|
 |
Aeba |
20-Apr-2018 16:20 |
- |
|
 |
Against Kids |
20-Apr-2018 16:20 |
- |
|
 |
Aki Sirkesalo |
20-Apr-2018 16:20 |
- |
|
 |
Alan Kelly |
20-Apr-2018 16:20 |
- |
|
 |
Alex Kidd |
20-Apr-2018 16:20 |
- |
|
 |
Almila, Nordgren, Kokkonen; Arktinen hysteria |
20-Apr-2018 16:20 |
- |
|
 |
Amat Amigos |
20-Apr-2018 16:20 |
- |
|
 |
Angel-Ho |
20-Apr-2018 16:20 |
- |
|
 |
Angeles |
20-Apr-2018 16:20 |
- |
|
 |
Anton Milton & Glorified |
20-Apr-2018 16:20 |
- |
|
 |
Antonín Dvořák; London Philharmonic Orchestra, Sir Charles Mackerras |
20-Apr-2018 16:20 |
- |
|
 |
Area 51 |
20-Apr-2018 16:20 |
- |
|
 |
Arkon Fly |
20-Apr-2018 16:20 |
- |
|
 |
Arnold Schönberg; Juilliard String Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Artur Rojek |
20-Apr-2018 16:20 |
- |
|
 |
Audio Code |
20-Apr-2018 16:20 |
- |
|
 |
Augusten Burroughs gelesen von August Diehl |
20-Apr-2018 16:20 |
- |
|
 |
Bach; Murray Perahia |
20-Apr-2018 16:20 |
- |
|
 |
Bang on a Can |
20-Apr-2018 16:20 |
- |
|
 |
Bartók; Christa Ludwig, Walter Berry, London Symphony Orchestra, István Kertész |
20-Apr-2018 16:20 |
- |
|
 |
Berliner Philharmoniker & Simon Rattle |
20-Apr-2018 16:20 |
- |
|
 |
Bert Weedon |
20-Apr-2018 16:20 |
- |
|
 |
Black Attack |
20-Apr-2018 16:20 |
- |
|
 |
Boomerang |
20-Apr-2018 16:20 |
- |
|
 |
Brahms; Domus |
20-Apr-2018 16:20 |
- |
|
 |
Brahms; Yehudi Menuhin, Willi Boskovsky, Emanuel Brabec, Orchestre du Festival de Lucerne, Wiener Philharmoniker, Wilhelm Furtwängler |
20-Apr-2018 16:20 |
- |
|
 |
Braquemard |
20-Apr-2018 16:20 |
- |
|
 |
Britten, Bryars, Tavener; Matthew Barley |
20-Apr-2018 16:20 |
- |
|
 |
Cactus Child |
20-Apr-2018 16:20 |
- |
|
 |
Cassle |
20-Apr-2018 16:20 |
- |
|
 |
Chaos Blood |
20-Apr-2018 16:20 |
- |
|
 |
Christina Aguilera feat. Redman |
20-Apr-2018 16:20 |
- |
|
 |
Counterfist |
20-Apr-2018 16:20 |
- |
|
 |
Cumhurbaşkanlığı Klasik Türk Müziği Korosu |
20-Apr-2018 16:20 |
- |
|
 |
Curare |
20-Apr-2018 16:20 |
- |
|
 |
Cycle of the Raven Talons |
20-Apr-2018 16:20 |
- |
|
 |
DJ Baku |
20-Apr-2018 16:20 |
- |
|
 |
DJ Dero |
20-Apr-2018 16:20 |
- |
|
 |
DJ Ninja Love Mistake |
20-Apr-2018 16:20 |
- |
|
 |
DJ Q |
20-Apr-2018 16:20 |
- |
|
 |
DaMonz |
20-Apr-2018 16:20 |
- |
|
 |
Dagmar Hoßfeld gelesen von Ann-Cathrin Sudhoff |
20-Apr-2018 16:20 |
- |
|
 |
Damien Dempsey |
20-Apr-2018 16:20 |
- |
|
 |
Dance Reaction |
20-Apr-2018 16:20 |
- |
|
 |
Darkeater |
20-Apr-2018 16:20 |
- |
|
 |
Davie Forbes |
20-Apr-2018 16:20 |
- |
|
 |
Davie Forbes & M.C. Cyclone |
20-Apr-2018 16:20 |
- |
|
 |
Dead by Morning |
20-Apr-2018 16:20 |
- |
|
 |
Defiance |
20-Apr-2018 16:20 |
- |
|
 |
Den Saakaldte |
20-Apr-2018 16:20 |
- |
|
 |
Dick Heckstall-Smith and friends |
20-Apr-2018 16:20 |
- |
|
 |
Die Funkhausgruppe |
20-Apr-2018 16:20 |
- |
|
 |
Die kranken Schwestern |
20-Apr-2018 16:20 |
- |
|
 |
Dominik Eulberg & Gabriel Ananda |
20-Apr-2018 16:20 |
- |
|
 |
Dorisburg |
20-Apr-2018 16:20 |
- |
|
 |
Doug Tielli |
20-Apr-2018 16:20 |
- |
|
 |
Downcity Armory |
20-Apr-2018 16:20 |
- |
|
 |
E. Fugu |
20-Apr-2018 16:20 |
- |
|
 |
E.B. Daddy of Da Hood |
20-Apr-2018 16:20 |
- |
|
 |
East 57th St. feat. Donna Allen |
20-Apr-2018 16:20 |
- |
|
 |
Eastern Sidekick |
20-Apr-2018 16:20 |
- |
|
 |
Eatmewhileimhot! |
20-Apr-2018 16:20 |
- |
|
 |
Ebe'n'Drum |
20-Apr-2018 16:20 |
- |
|
 |
Effello & Niko |
20-Apr-2018 16:20 |
- |
|
 |
Embryo feat. Chris Karrer, El Hussaine Kili, Yoruba Dun Dun Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Emily Mure |
20-Apr-2018 16:20 |
- |
|
 |
Ephemer |
20-Apr-2018 16:20 |
- |
|
 |
Example + DJ Wire |
20-Apr-2018 16:20 |
- |
|
 |
Exploding Head Syndrome |
20-Apr-2018 16:20 |
- |
|
 |
Federico Locchi & Frankie Watch |
20-Apr-2018 16:20 |
- |
|
 |
FireLake |
20-Apr-2018 16:20 |
- |
|
 |
Flavel & Neto |
20-Apr-2018 16:20 |
- |
|
 |
Formerly Known as Oedipusaurus Rex |
20-Apr-2018 16:20 |
- |
|
 |
Frishiro |
20-Apr-2018 16:20 |
- |
|
 |
Füxa |
20-Apr-2018 16:20 |
- |
|
 |
GOL |
20-Apr-2018 16:20 |
- |
|
 |
Gershwin; Michael Tilson Thomas, Eugene Ormandy |
20-Apr-2018 16:20 |
- |
|
 |
Giovanni Girolamo Kapsberger ; L'Arpeggiata, Christina Pluhar |
20-Apr-2018 16:20 |
- |
|
 |
Gormenghast |
20-Apr-2018 16:20 |
- |
|
 |
Gosia Andrzejewicz |
20-Apr-2018 16:20 |
- |
|
 |
Grindsuffering |
20-Apr-2018 16:20 |
- |
|
 |
Group of the Altos |
20-Apr-2018 16:20 |
- |
|
 |
Gunja |
20-Apr-2018 16:20 |
- |
|
 |
Hands on The Stereo |
20-Apr-2018 16:20 |
- |
|
 |
Hanna Talikainen |
20-Apr-2018 16:20 |
- |
|
 |
Harriet Cohen |
20-Apr-2018 16:20 |
- |
|
 |
Headache City |
20-Apr-2018 16:20 |
- |
|
 |
Henderwyd |
20-Apr-2018 16:20 |
- |
|
 |
Hip Optimist |
20-Apr-2018 16:20 |
- |
|
 |
Hocus Pocus |
20-Apr-2018 16:20 |
- |
|
 |
Hypocras |
20-Apr-2018 16:20 |
- |
|
 |
ICATCHFIRE |
20-Apr-2018 16:20 |
- |
|
 |
Immortal Empire |
20-Apr-2018 16:20 |
- |
|
 |
Infectious Catheter Therapy |
20-Apr-2018 16:20 |
- |
|
 |
Ismo Alanko Säätiö |
20-Apr-2018 16:20 |
- |
|
 |
Janet feat. Q‐Tip & Joni Mitchell |
20-Apr-2018 16:20 |
- |
|
 |
Jari Perkiömäki Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Jean-François Laporte |
20-Apr-2018 16:20 |
- |
|
 |
Jerry Hadley |
20-Apr-2018 16:20 |
- |
|
 |
Johann Sebastian Bach; Yehudi Menuhin, Christian Ferras, Robert Masters Chamber Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Johannes Brahms; Eugen Jochum, Jessye Norman, Jorma Hynninen, Klaus Tennstedt |
20-Apr-2018 16:20 |
- |
|
 |
Johannes Heil |
20-Apr-2018 16:20 |
- |
|
 |
John & Jacob |
20-Apr-2018 16:20 |
- |
|
 |
John Cutrone |
20-Apr-2018 16:20 |
- |
|
 |
John Kongos |
20-Apr-2018 16:20 |
- |
|
 |
Johnny Legend & His Rockabilly Bastards |
20-Apr-2018 16:20 |
- |
|
 |
Jonell Mosser |
20-Apr-2018 16:20 |
- |
|
 |
Juliet Lyons |
20-Apr-2018 16:20 |
- |
|
 |
June |
20-Apr-2018 16:20 |
- |
|
 |
K A Morton |
20-Apr-2018 16:20 |
- |
|
 |
Kahitna |
20-Apr-2018 16:20 |
- |
|
 |
Kauko Röyhkä & Mikkelin kaupungin jousiorkesteri |
20-Apr-2018 16:20 |
- |
|
 |
Kenny Kilgore |
20-Apr-2018 16:20 |
- |
|
 |
Kill the Precedent |
20-Apr-2018 16:20 |
- |
|
 |
Kortatu ⁄ Cicatriz ⁄ Jotakie ⁄ Kontuz Hi! |
20-Apr-2018 16:20 |
- |
|
 |
Kovács Kati, Szécsi Pál, Zalatnay Sarolta, Aradszky László, Poór Péter, Kovács József, Mary Zsuzsi, Zorán, Illés & Koós János |
20-Apr-2018 16:20 |
- |
|
 |
Kowton vs Bashmore |
20-Apr-2018 16:20 |
- |
|
 |
Kozeljnik |
20-Apr-2018 16:20 |
- |
|
 |
Kuunkuiskaajat |
20-Apr-2018 16:20 |
- |
|
 |
Laura Babineau |
20-Apr-2018 16:20 |
- |
|
 |
Les Cris de Paris |
20-Apr-2018 16:20 |
- |
|
 |
Les Passants |
20-Apr-2018 16:20 |
- |
|
 |
Les Percussions de Guinée avec El Hadj Djeli Sory Kouyate |
20-Apr-2018 16:20 |
- |
|
 |
Lihkören |
20-Apr-2018 16:20 |
- |
|
 |
London Symphony Orchestra, Richard Bonynge |
20-Apr-2018 16:20 |
- |
|
 |
Lord Hakim |
20-Apr-2018 16:20 |
- |
|
 |
Louise Korthals |
20-Apr-2018 16:20 |
- |
|
 |
Lucy Marsh ⁄ Columbia Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Ludwig van Beethoven; London Symphony Orchestra, Antal Doráti |
20-Apr-2018 16:20 |
- |
|
 |
M-Seven |
20-Apr-2018 16:20 |
- |
|
 |
MALIO |
20-Apr-2018 16:20 |
- |
|
 |
MIAVA |
20-Apr-2018 16:20 |
- |
|
 |
Malkit Singh |
20-Apr-2018 16:20 |
- |
|
 |
Masahiko Kimura, Motoaki Furukawa & Mariko Egawa |
20-Apr-2018 16:20 |
- |
|
 |
Mascot Fight |
20-Apr-2018 16:20 |
- |
|
 |
Massimo |
20-Apr-2018 16:20 |
- |
|
 |
Massive Attack vs. Burial |
20-Apr-2018 16:20 |
- |
|
 |
Mathys Roets |
20-Apr-2018 16:20 |
- |
|
 |
Max Reger, Eugène Ysaÿe; Erling Blöndal Bengtsson |
20-Apr-2018 16:20 |
- |
|
 |
Maxxwell & Tempesta |
20-Apr-2018 16:20 |
- |
|
 |
Mexvin |
20-Apr-2018 16:20 |
- |
|
 |
Miroslav Kejmar, Capella Istropolitana, Petr Škvor |
20-Apr-2018 16:20 |
- |
|
 |
Mirror of Deception |
20-Apr-2018 16:20 |
- |
|
 |
Mitch Murder & Satellite Young |
20-Apr-2018 16:20 |
- |
|
 |
Mohammed Rafi, Lata Mangeshkar, Manhar Udhas, Mala Sinha, Mahendra Kapoor & Poornima |
20-Apr-2018 16:20 |
- |
|
 |
Mondrian Oak |
20-Apr-2018 16:20 |
- |
|
 |
Morgenstern |
20-Apr-2018 16:20 |
- |
|
 |
Mozart; The Academy of Ancient Music, Jaap Schröder, Christopher Hogwood |
20-Apr-2018 16:20 |
- |
|
 |
Mozart; The Chamber Orchestra of Europe, James Galway, Marisa Robles |
20-Apr-2018 16:20 |
- |
|
 |
Muddy Brothers |
20-Apr-2018 16:20 |
- |
|
 |
Mundo Livre S⁄A |
20-Apr-2018 16:20 |
- |
|
 |
Muzzle |
20-Apr-2018 16:20 |
- |
|
 |
Narcotik Affluence |
20-Apr-2018 16:20 |
- |
|
 |
Natascha Wright |
20-Apr-2018 16:20 |
- |
|
 |
Neisha |
20-Apr-2018 16:20 |
- |
|
 |
Nigel Eaton & Friends |
20-Apr-2018 16:20 |
- |
|
 |
Night Hikes |
20-Apr-2018 16:20 |
- |
|
 |
Ninja Camel |
20-Apr-2018 16:20 |
- |
|
 |
No Fun |
20-Apr-2018 16:20 |
- |
|
 |
No Sports |
20-Apr-2018 16:20 |
- |
|
 |
Ojos Locos |
20-Apr-2018 16:20 |
- |
|
 |
Over the Atlantic |
20-Apr-2018 16:20 |
- |
|
 |
Pacho y Cirilo |
20-Apr-2018 16:20 |
- |
|
 |
Pascal Gemme & Mario Loiselle |
20-Apr-2018 16:20 |
- |
|
 |
Paul Norton |
20-Apr-2018 16:20 |
- |
|
 |
Peace, Love & Pitbulls |
20-Apr-2018 16:20 |
- |
|
 |
Platinium |
20-Apr-2018 16:20 |
- |
|
 |
Pneumatic Detach ⁄ C2 |
20-Apr-2018 16:20 |
- |
|
 |
Pollo Del Mar |
20-Apr-2018 16:20 |
- |
|
 |
Posslust |
20-Apr-2018 16:20 |
- |
|
 |
Pouca Sorte Deus da Morte |
20-Apr-2018 16:20 |
- |
|
 |
Push Button Objects |
20-Apr-2018 16:20 |
- |
|
 |
Quantum |
20-Apr-2018 16:20 |
- |
|
 |
R.P. Boals & The Soals |
20-Apr-2018 16:20 |
- |
|
 |
Rafael Toral ⁄ Davu Seru |
20-Apr-2018 16:20 |
- |
|
 |
Rasmus |
20-Apr-2018 16:20 |
- |
|
 |
Repulse |
20-Apr-2018 16:20 |
- |
|
 |
Richard Wagner; Chor und Orchester der Bayerischen Staatsoper, Clemens Krauss |
20-Apr-2018 16:20 |
- |
|
 |
Richard Wagner; Erich Leinsdorf, Metropolitan Opera Orchestra, Metropolitan Opera Chorus, Lauritz Melchior, Helen Traubel |
20-Apr-2018 16:20 |
- |
|
 |
Rick Dees & His Cast of Idiots |
20-Apr-2018 16:20 |
- |
|
 |
Rico |
20-Apr-2018 16:20 |
- |
|
 |
Rod Davies |
20-Apr-2018 16:20 |
- |
|
 |
Rodney D |
20-Apr-2018 16:20 |
- |
|
 |
Rose Vialpando & Salomon Lopez |
20-Apr-2018 16:20 |
- |
|
 |
Roses' Tribe |
20-Apr-2018 16:20 |
- |
|
 |
Sabota |
20-Apr-2018 16:20 |
- |
|
 |
Schallfaktor |
20-Apr-2018 16:20 |
- |
|
 |
Sergei Lyapunov; BBC Scottish Symphony Orchestra, Martyn Brabbins, Hamish Milne |
20-Apr-2018 16:20 |
- |
|
 |
Shauna Davis |
20-Apr-2018 16:20 |
- |
|
 |
Shay |
20-Apr-2018 16:20 |
- |
|
 |
Shit Kid |
20-Apr-2018 16:20 |
- |
|
 |
Shock Poets |
20-Apr-2018 16:20 |
- |
|
 |
Shostakovich, Prokofiev; Gustav Schmahl, Dresdner Philharmonie, Kurt Masur |
20-Apr-2018 16:20 |
- |
|
 |
Sibelius; Scottish National Orchestra, Sir Alexander Gibson |
20-Apr-2018 16:20 |
- |
|
 |
Solar Flare vs. Rorcal |
20-Apr-2018 16:20 |
- |
|
 |
Spinee |
20-Apr-2018 16:20 |
- |
|
 |
Star Insight |
20-Apr-2018 16:20 |
- |
|
 |
Stimulant DJs |
20-Apr-2018 16:20 |
- |
|
 |
Syllyk ⁄ Koji Marutani |
20-Apr-2018 16:20 |
- |
|
 |
T.H.E. Rutto |
20-Apr-2018 16:20 |
- |
|
 |
Tara Priya |
20-Apr-2018 16:20 |
- |
|
 |
Texas Terri Bomb! |
20-Apr-2018 16:20 |
- |
|
 |
The Beatles with Billy Preston |
20-Apr-2018 16:20 |
- |
|
 |
The Chico Hamilton Quintet & Elmer Bernstein |
20-Apr-2018 16:20 |
- |
|
 |
The Crowd Scene |
20-Apr-2018 16:20 |
- |
|
 |
The Delmore Brothers |
20-Apr-2018 16:20 |
- |
|
 |
The Drills |
20-Apr-2018 16:20 |
- |
|
 |
The Hypnomen |
20-Apr-2018 16:20 |
- |
|
 |
The Laughing Dogs |
20-Apr-2018 16:20 |
- |
|
 |
The Lemonheads |
20-Apr-2018 16:20 |
- |
|
 |
The Monarchs |
20-Apr-2018 16:20 |
- |
|
 |
The Mor(R)ons |
20-Apr-2018 16:20 |
- |
|
 |
The Red Hot Valentines ⁄ Retro Morning |
20-Apr-2018 16:20 |
- |
|
 |
The UV Race |
20-Apr-2018 16:20 |
- |
|
 |
The Waffle Machine Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Thee Oops |
20-Apr-2018 16:20 |
- |
|
 |
Thorns of Hate |
20-Apr-2018 16:20 |
- |
|
 |
Tommy Malone |
20-Apr-2018 16:20 |
- |
|
 |
Trash the Dress |
20-Apr-2018 16:20 |
- |
|
 |
Ultimate Buzz |
20-Apr-2018 16:20 |
- |
|
 |
Ultraje a rigor |
20-Apr-2018 16:20 |
- |
|
 |
Ur Draugr |
20-Apr-2018 16:20 |
- |
|
 |
Veinte Tres |
20-Apr-2018 16:20 |
- |
|
 |
Veirg |
20-Apr-2018 16:20 |
- |
|
 |
Velcro Mary |
20-Apr-2018 16:20 |
- |
|
 |
Voices of Kwahn |
20-Apr-2018 16:20 |
- |
|
 |
Von Goat |
20-Apr-2018 16:20 |
- |
|
 |
Went |
20-Apr-2018 16:20 |
- |
|
 |
Willard Grant Conspiracy |
20-Apr-2018 16:20 |
- |
|
 |
Willy Tea Taylor |
20-Apr-2018 16:20 |
- |
|
 |
Wingdom |
20-Apr-2018 16:20 |
- |
|
 |
Youth in Asia |
20-Apr-2018 16:20 |
- |
|
 |
Zi:LiE-YA |
20-Apr-2018 16:20 |
- |
|
 |
Zемфира |
20-Apr-2018 16:20 |
- |
|
 |
bis ⁄ Ghosts of Dead Airplanes |
20-Apr-2018 16:20 |
- |
|
 |
miLù |
20-Apr-2018 16:20 |
- |
|
 |
sajjanu |
20-Apr-2018 16:20 |
- |
|
 |
Μαρίκα Νίνου |
20-Apr-2018 16:20 |
- |
|
 |
つじあやの |
20-Apr-2018 16:20 |
- |
|
 |
ホッピー神山 |
20-Apr-2018 16:20 |
- |
|
 |
久川綾 & 平松晶子 |
20-Apr-2018 16:20 |
- |
|
 |
二手玫瑰 |
20-Apr-2018 16:20 |
- |
|
 |
郭采潔 |
20-Apr-2018 16:20 |
- |
|
|